C19H20N4O5 — CID 169329586
N-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-methoxyphenyl]-2,2-dimethylpropanamide (PubChem CID 169329586) has the molecular formula C19H20N4O5 and a molecular weight of 384.39 g/mol. Its IUPAC name is N-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-methoxyphenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-methoxyphenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 169329586 |
| Molecular Formula | C19H20N4O5 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-methoxyphenyl]-2,2-dimethylpropanamide |
| SMILES | COc1cc(-n2c(N)c3c(cc2=O)C(=O)NC3=O)ccc1NC(=O)C(C)(C)C |
| InChI | InChI=1S/C19H20N4O5/c1-19(2,3)18(27)21-11-6-5-9(7-12(11)28-4)23-13(24)8-10-14(15(23)20)17(26)22-16(10)25/h5-8H,20H2,1-4H3,(H,21,27)(H,22,25,26) |
| InChIKey | OKCBYROXLIUYON-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|