C18H17ClN4O5 — CID 169330074
tert-butyl N-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-chlorophenyl]carbamate (PubChem CID 169330074) has the molecular formula C18H17ClN4O5 and a molecular weight of 404.81 g/mol. Its IUPAC name is tert-butyl N-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-chlorophenyl]carbamate.
| Compound Name | tert-butyl N-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-chlorophenyl]carbamate |
|---|---|
| PubChem CID | 169330074 |
| Molecular Formula | C18H17ClN4O5 |
| Molecular Weight | 404.81 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | tert-butyl N-[4-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-2-chlorophenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(-n2c(N)c3c(cc2=O)C(=O)NC3=O)cc1Cl |
| InChI | InChI=1S/C18H17ClN4O5/c1-18(2,3)28-17(27)21-11-5-4-8(6-10(11)19)23-12(24)7-9-13(14(23)20)16(26)22-15(9)25/h4-7H,20H2,1-3H3,(H,21,27)(H,22,25,26) |
| InChIKey | XFGVBUAAPSNSCU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.81 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|