C22H25N5O7 — CID 169328793
methyl 3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]benzoate (PubChem CID 169328793) has the molecular formula C22H25N5O7 and a molecular weight of 471.47 g/mol. Its IUPAC name is methyl 3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]benzoate.
| Compound Name | methyl 3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]benzoate |
|---|---|
| PubChem CID | 169328793 |
| Molecular Formula | C22H25N5O7 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | methyl 3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]benzoate |
| SMILES | COC(=O)c1ccc(NCCNC(=O)OC(C)(C)C)c(-n2c(N)c3c(cc2=O)C(=O)NC3=O)c1 |
| InChI | InChI=1S/C22H25N5O7/c1-22(2,3)34-21(32)25-8-7-24-13-6-5-11(20(31)33-4)9-14(13)27-15(28)10-12-16(17(27)23)19(30)26-18(12)29/h5-6,9-10,24H,7-8,23H2,1-4H3,(H,25,32)(H,26,29,30) |
| InChIKey | NMXGSTDBLJPILS-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 170.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|