C20H22N4O5 — CID 169330920
tert-butyl N-[[3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-5-methylphenyl]methyl]carbamate (PubChem CID 169330920) has the molecular formula C20H22N4O5 and a molecular weight of 398.42 g/mol. Its IUPAC name is tert-butyl N-[[3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-5-methylphenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-5-methylphenyl]methyl]carbamate |
|---|---|
| PubChem CID | 169330920 |
| Molecular Formula | C20H22N4O5 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | tert-butyl N-[[3-(4-amino-1,3,6-trioxopyrrolo[3,4-c]pyridin-5-yl)-5-methylphenyl]methyl]carbamate |
| SMILES | Cc1cc(CNC(=O)OC(C)(C)C)cc(-n2c(N)c3c(cc2=O)C(=O)NC3=O)c1 |
| InChI | InChI=1S/C20H22N4O5/c1-10-5-11(9-22-19(28)29-20(2,3)4)7-12(6-10)24-14(25)8-13-15(16(24)21)18(27)23-17(13)26/h5-8H,9,21H2,1-4H3,(H,22,28)(H,23,26,27) |
| InChIKey | QJKVKQIYZHGDCB-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|