C20H15BrN4O3 — CID 169331073
4-amino-5-[2-(benzylamino)-5-bromophenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169331073) has the molecular formula C20H15BrN4O3 and a molecular weight of 439.27 g/mol. Its IUPAC name is 4-amino-5-[2-(benzylamino)-5-bromophenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[2-(benzylamino)-5-bromophenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169331073 |
| Molecular Formula | C20H15BrN4O3 |
| Molecular Weight | 439.27 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | 4-amino-5-[2-(benzylamino)-5-bromophenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1cc(Br)ccc1NCc1ccccc1)C(=O)NC2=O |
| InChI | InChI=1S/C20H15BrN4O3/c21-12-6-7-14(23-10-11-4-2-1-3-5-11)15(8-12)25-16(26)9-13-17(18(25)22)20(28)24-19(13)27/h1-9,23H,10,22H2,(H,24,27,28) |
| InChIKey | NYPCJJKWYDPPBG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|