C24H18N6O4 — CID 169330574
4-amino-5-[2-(benzylamino)-5-(6-oxo-1H-pyridazin-3-yl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169330574) has the molecular formula C24H18N6O4 and a molecular weight of 454.45 g/mol. Its IUPAC name is 4-amino-5-[2-(benzylamino)-5-(6-oxo-1H-pyridazin-3-yl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[2-(benzylamino)-5-(6-oxo-1H-pyridazin-3-yl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169330574 |
| Molecular Formula | C24H18N6O4 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 4-amino-5-[2-(benzylamino)-5-(6-oxo-1H-pyridazin-3-yl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1cc(-c3ccc(=O)[nH]n3)ccc1NCc1ccccc1)C(=O)NC2=O |
| InChI | InChI=1S/C24H18N6O4/c25-22-21-15(23(33)27-24(21)34)11-20(32)30(22)18-10-14(16-8-9-19(31)29-28-16)6-7-17(18)26-12-13-4-2-1-3-5-13/h1-11,26H,12,25H2,(H,29,31)(H,27,33,34) |
| InChIKey | JSPQXQOINZNDRT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 151.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|