C23H21N5O4 — CID 168557819
3-[2-(benzylamino)-5-(6-oxo-1H-pyridazin-3-yl)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168557819) has the molecular formula C23H21N5O4 and a molecular weight of 431.45 g/mol. Its IUPAC name is 3-[2-(benzylamino)-5-(6-oxo-1H-pyridazin-3-yl)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-[2-(benzylamino)-5-(6-oxo-1H-pyridazin-3-yl)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168557819 |
| Molecular Formula | C23H21N5O4 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 3-[2-(benzylamino)-5-(6-oxo-1H-pyridazin-3-yl)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2cc(-c3ccc(=O)[nH]n3)ccc2NCc2ccccc2)C(=O)N1CCO |
| InChI | InChI=1S/C23H21N5O4/c29-11-10-28-22(31)13-20(23(28)32)25-19-12-16(17-8-9-21(30)27-26-17)6-7-18(19)24-14-15-4-2-1-3-5-15/h1-9,12-13,24-25,29H,10-11,14H2,(H,27,30) |
| InChIKey | FCNKYBIQRIKFOW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 127.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|