C16H15N3O5 — CID 168557551
1-(2-hydroxyethyl)-3-[4-[5-(hydroxymethyl)-1,2-oxazol-3-yl]anilino]pyrrole-2,5-dione (PubChem CID 168557551) has the molecular formula C16H15N3O5 and a molecular weight of 329.31 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[4-[5-(hydroxymethyl)-1,2-oxazol-3-yl]anilino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[4-[5-(hydroxymethyl)-1,2-oxazol-3-yl]anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168557551 |
| Molecular Formula | C16H15N3O5 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[4-[5-(hydroxymethyl)-1,2-oxazol-3-yl]anilino]pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2ccc(-c3cc(CO)on3)cc2)C(=O)N1CCO |
| InChI | InChI=1S/C16H15N3O5/c20-6-5-19-15(22)8-14(16(19)23)17-11-3-1-10(2-4-11)13-7-12(9-21)24-18-13/h1-4,7-8,17,20-21H,5-6,9H2 |
| InChIKey | OANDKYYNLCJZDT-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|