C23H19N3O5 — CID 168558598
2-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]-6-methylquinoline-4-carboxylic acid (PubChem CID 168558598) has the molecular formula C23H19N3O5 and a molecular weight of 417.42 g/mol. Its IUPAC name is 2-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]-6-methylquinoline-4-carboxylic acid.
| Compound Name | 2-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]-6-methylquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 168558598 |
| Molecular Formula | C23H19N3O5 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 2-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]-6-methylquinoline-4-carboxylic acid |
| SMILES | Cc1ccc2nc(-c3ccc(NC4=CC(=O)N(CCO)C4=O)cc3)cc(C(=O)O)c2c1 |
| InChI | InChI=1S/C23H19N3O5/c1-13-2-7-18-16(10-13)17(23(30)31)11-19(25-18)14-3-5-15(6-4-14)24-20-12-21(28)26(8-9-27)22(20)29/h2-7,10-12,24,27H,8-9H2,1H3,(H,30,31) |
| InChIKey | JGTITGFMDLUWEX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|