C20H18N4O3 — CID 168558280
1-(2-hydroxyethyl)-3-[3-(6-methyl-1H-benzimidazol-2-yl)anilino]pyrrole-2,5-dione (PubChem CID 168558280) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[3-(6-methyl-1H-benzimidazol-2-yl)anilino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[3-(6-methyl-1H-benzimidazol-2-yl)anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168558280 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[3-(6-methyl-1H-benzimidazol-2-yl)anilino]pyrrole-2,5-dione |
| SMILES | Cc1ccc2nc(-c3cccc(NC4=CC(=O)N(CCO)C4=O)c3)[nH]c2c1 |
| InChI | InChI=1S/C20H18N4O3/c1-12-5-6-15-16(9-12)23-19(22-15)13-3-2-4-14(10-13)21-17-11-18(26)24(7-8-25)20(17)27/h2-6,9-11,21,25H,7-8H2,1H3,(H,22,23) |
| InChIKey | XZAIUPZQYRILFT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|