C16H14N6O3S — CID 168560474
1-(2-hydroxyethyl)-3-[3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)anilino]pyrrole-2,5-dione (PubChem CID 168560474) has the molecular formula C16H14N6O3S and a molecular weight of 370.39 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)anilino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168560474 |
| Molecular Formula | C16H14N6O3S |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)anilino]pyrrole-2,5-dione |
| SMILES | Cc1nnc2sc(-c3cccc(NC4=CC(=O)N(CCO)C4=O)c3)nn12 |
| InChI | InChI=1S/C16H14N6O3S/c1-9-18-19-16-22(9)20-14(26-16)10-3-2-4-11(7-10)17-12-8-13(24)21(5-6-23)15(12)25/h2-4,7-8,17,23H,5-6H2,1H3 |
| InChIKey | FTSAPOIDLXFPTJ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 112.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|