C22H17N7O3 — CID 168557973
1-(2-hydroxyethyl)-3-[3-(3-pyridin-4-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)anilino]pyrrole-2,5-dione (PubChem CID 168557973) has the molecular formula C22H17N7O3 and a molecular weight of 427.42 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[3-(3-pyridin-4-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)anilino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[3-(3-pyridin-4-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168557973 |
| Molecular Formula | C22H17N7O3 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[3-(3-pyridin-4-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)anilino]pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2cccc(-c3ccc4nnc(-c5ccncc5)n4n3)c2)C(=O)N1CCO |
| InChI | InChI=1S/C22H17N7O3/c30-11-10-28-20(31)13-18(22(28)32)24-16-3-1-2-15(12-16)17-4-5-19-25-26-21(29(19)27-17)14-6-8-23-9-7-14/h1-9,12-13,24,30H,10-11H2 |
| InChIKey | ITCHFIMXMQDITK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 125.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|