C14H12N4O4S — CID 168559149
1-(2-hydroxyethyl)-3-[3-(1,3,4-thiadiazol-2-yloxy)anilino]pyrrole-2,5-dione (PubChem CID 168559149) has the molecular formula C14H12N4O4S and a molecular weight of 332.34 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[3-(1,3,4-thiadiazol-2-yloxy)anilino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[3-(1,3,4-thiadiazol-2-yloxy)anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168559149 |
| Molecular Formula | C14H12N4O4S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[3-(1,3,4-thiadiazol-2-yloxy)anilino]pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2cccc(Oc3nncs3)c2)C(=O)N1CCO |
| InChI | InChI=1S/C14H12N4O4S/c19-5-4-18-12(20)7-11(13(18)21)16-9-2-1-3-10(6-9)22-14-17-15-8-23-14/h1-3,6-8,16,19H,4-5H2 |
| InChIKey | NDNAAAGHCRJGNO-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|