C14H17N3O3 — CID 168556942
3-[3-(dimethylamino)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168556942) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 3-[3-(dimethylamino)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-[3-(dimethylamino)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168556942 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 3-[3-(dimethylamino)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | CN(C)c1cccc(NC2=CC(=O)N(CCO)C2=O)c1 |
| InChI | InChI=1S/C14H17N3O3/c1-16(2)11-5-3-4-10(8-11)15-12-9-13(19)17(6-7-18)14(12)20/h3-5,8-9,15,18H,6-7H2,1-2H3 |
| InChIKey | MXJXKRDBNYNSFR-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|