C19H15IN4O3 — CID 168557338
1-(2-hydroxyethyl)-3-[3-(6-iodoimidazo[1,2-a]pyridin-2-yl)anilino]pyrrole-2,5-dione (PubChem CID 168557338) has the molecular formula C19H15IN4O3 and a molecular weight of 474.26 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[3-(6-iodoimidazo[1,2-a]pyridin-2-yl)anilino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[3-(6-iodoimidazo[1,2-a]pyridin-2-yl)anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168557338 |
| Molecular Formula | C19H15IN4O3 |
| Molecular Weight | 474.26 g/mol |
| Exact Mass | 474.02 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[3-(6-iodoimidazo[1,2-a]pyridin-2-yl)anilino]pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2cccc(-c3cn4cc(I)ccc4n3)c2)C(=O)N1CCO |
| InChI | InChI=1S/C19H15IN4O3/c20-13-4-5-17-22-16(11-23(17)10-13)12-2-1-3-14(8-12)21-15-9-18(26)24(6-7-25)19(15)27/h1-5,8-11,21,25H,6-7H2 |
| InChIKey | MLUBQTOOUVULQM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|