C20H17N3O4 — CID 168560502
1-(2-hydroxyethyl)-3-[[2-(3-methylphenyl)-1,3-benzoxazol-6-yl]amino]pyrrole-2,5-dione (PubChem CID 168560502) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[[2-(3-methylphenyl)-1,3-benzoxazol-6-yl]amino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[[2-(3-methylphenyl)-1,3-benzoxazol-6-yl]amino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168560502 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[[2-(3-methylphenyl)-1,3-benzoxazol-6-yl]amino]pyrrole-2,5-dione |
| SMILES | Cc1cccc(-c2nc3ccc(NC4=CC(=O)N(CCO)C4=O)cc3o2)c1 |
| InChI | InChI=1S/C20H17N3O4/c1-12-3-2-4-13(9-12)19-22-15-6-5-14(10-17(15)27-19)21-16-11-18(25)23(7-8-24)20(16)26/h2-6,9-11,21,24H,7-8H2,1H3 |
| InChIKey | OQQKBQWNCQJEKM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|