C19H14BrN3O4 — CID 168559260
3-[[2-(2-bromophenyl)-1,3-benzoxazol-5-yl]amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168559260) has the molecular formula C19H14BrN3O4 and a molecular weight of 428.24 g/mol. Its IUPAC name is 3-[[2-(2-bromophenyl)-1,3-benzoxazol-5-yl]amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-[[2-(2-bromophenyl)-1,3-benzoxazol-5-yl]amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168559260 |
| Molecular Formula | C19H14BrN3O4 |
| Molecular Weight | 428.24 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | 3-[[2-(2-bromophenyl)-1,3-benzoxazol-5-yl]amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2ccc3oc(-c4ccccc4Br)nc3c2)C(=O)N1CCO |
| InChI | InChI=1S/C19H14BrN3O4/c20-13-4-2-1-3-12(13)18-22-14-9-11(5-6-16(14)27-18)21-15-10-17(25)23(7-8-24)19(15)26/h1-6,9-10,21,24H,7-8H2 |
| InChIKey | KFKJCWVQXCOKBB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|