C16H14BrClN2O2 — CID 168638674
1-[[2-(2-bromophenyl)-1,3-benzoxazol-5-yl]amino]-3-chloropropan-2-ol (PubChem CID 168638674) has the molecular formula C16H14BrClN2O2 and a molecular weight of 381.66 g/mol. Its IUPAC name is 1-[[2-(2-bromophenyl)-1,3-benzoxazol-5-yl]amino]-3-chloropropan-2-ol.
| Compound Name | 1-[[2-(2-bromophenyl)-1,3-benzoxazol-5-yl]amino]-3-chloropropan-2-ol |
|---|---|
| PubChem CID | 168638674 |
| Molecular Formula | C16H14BrClN2O2 |
| Molecular Weight | 381.66 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | 1-[[2-(2-bromophenyl)-1,3-benzoxazol-5-yl]amino]-3-chloropropan-2-ol |
| SMILES | OC(CCl)CNc1ccc2oc(-c3ccccc3Br)nc2c1 |
| InChI | InChI=1S/C16H14BrClN2O2/c17-13-4-2-1-3-12(13)16-20-14-7-10(5-6-15(14)22-16)19-9-11(21)8-18/h1-7,11,19,21H,8-9H2 |
| InChIKey | XNNTVZINYABYAE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.66 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|