C16H14Cl2N2O3 — CID 168595682
3-[[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]amino]propane-1,2-diol (PubChem CID 168595682) has the molecular formula C16H14Cl2N2O3 and a molecular weight of 353.21 g/mol. Its IUPAC name is 3-[[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]amino]propane-1,2-diol.
| Compound Name | 3-[[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]amino]propane-1,2-diol |
|---|---|
| PubChem CID | 168595682 |
| Molecular Formula | C16H14Cl2N2O3 |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 3-[[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]amino]propane-1,2-diol |
| SMILES | OCC(O)CNc1ccc2oc(-c3ccc(Cl)c(Cl)c3)nc2c1 |
| InChI | InChI=1S/C16H14Cl2N2O3/c17-12-3-1-9(5-13(12)18)16-20-14-6-10(2-4-15(14)23-16)19-7-11(22)8-21/h1-6,11,19,21-22H,7-8H2 |
| InChIKey | WPLPSVQWDWAEHR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |