C20H23ClN2O2 — CID 168638504
1-[4-(5-butan-2-yl-1,3-benzoxazol-2-yl)anilino]-3-chloropropan-2-ol (PubChem CID 168638504) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is 1-[4-(5-butan-2-yl-1,3-benzoxazol-2-yl)anilino]-3-chloropropan-2-ol.
| Compound Name | 1-[4-(5-butan-2-yl-1,3-benzoxazol-2-yl)anilino]-3-chloropropan-2-ol |
|---|---|
| PubChem CID | 168638504 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 1-[4-(5-butan-2-yl-1,3-benzoxazol-2-yl)anilino]-3-chloropropan-2-ol |
| SMILES | CCC(C)c1ccc2oc(-c3ccc(NCC(O)CCl)cc3)nc2c1 |
| InChI | InChI=1S/C20H23ClN2O2/c1-3-13(2)15-6-9-19-18(10-15)23-20(25-19)14-4-7-16(8-5-14)22-12-17(24)11-21/h4-10,13,17,22,24H,3,11-12H2,1-2H3 |
| InChIKey | XKDHJJXHBVZBBC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|