C18H14N4O4 — CID 168560585
1-(2-hydroxyethyl)-3-[(2-pyridin-2-yl-1,3-benzoxazol-5-yl)amino]pyrrole-2,5-dione (PubChem CID 168560585) has the molecular formula C18H14N4O4 and a molecular weight of 350.33 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[(2-pyridin-2-yl-1,3-benzoxazol-5-yl)amino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[(2-pyridin-2-yl-1,3-benzoxazol-5-yl)amino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168560585 |
| Molecular Formula | C18H14N4O4 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[(2-pyridin-2-yl-1,3-benzoxazol-5-yl)amino]pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2ccc3oc(-c4ccccn4)nc3c2)C(=O)N1CCO |
| InChI | InChI=1S/C18H14N4O4/c23-8-7-22-16(24)10-14(18(22)25)20-11-4-5-15-13(9-11)21-17(26-15)12-3-1-2-6-19-12/h1-6,9-10,20,23H,7-8H2 |
| InChIKey | LEDIJEMPEYUUDX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|