C20H17N5O3S — CID 168559429
1-(2-hydroxyethyl)-3-[4-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]anilino]pyrrole-2,5-dione (PubChem CID 168559429) has the molecular formula C20H17N5O3S and a molecular weight of 407.46 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[4-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]anilino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[4-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168559429 |
| Molecular Formula | C20H17N5O3S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[4-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]anilino]pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2ccc(Nc3nc(-c4ccccn4)cs3)cc2)C(=O)N1CCO |
| InChI | InChI=1S/C20H17N5O3S/c26-10-9-25-18(27)11-16(19(25)28)22-13-4-6-14(7-5-13)23-20-24-17(12-29-20)15-3-1-2-8-21-15/h1-8,11-12,22,26H,9-10H2,(H,23,24) |
| InChIKey | IXEXGEPSLIDVQC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|