C14H14N6O3 — CID 168560200
1-(2-hydroxyethyl)-3-[4-(2-methyltetrazol-5-yl)anilino]pyrrole-2,5-dione (PubChem CID 168560200) has the molecular formula C14H14N6O3 and a molecular weight of 314.31 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[4-(2-methyltetrazol-5-yl)anilino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[4-(2-methyltetrazol-5-yl)anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168560200 |
| Molecular Formula | C14H14N6O3 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[4-(2-methyltetrazol-5-yl)anilino]pyrrole-2,5-dione |
| SMILES | Cn1nnc(-c2ccc(NC3=CC(=O)N(CCO)C3=O)cc2)n1 |
| InChI | InChI=1S/C14H14N6O3/c1-19-17-13(16-18-19)9-2-4-10(5-3-9)15-11-8-12(22)20(6-7-21)14(11)23/h2-5,8,15,21H,6-7H2,1H3 |
| InChIKey | LFQHCLNJHATTRR-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|