C17H17ClN4O3 — CID 168558013
3-[4-(4-chloro-3,5-dimethylpyrazol-1-yl)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168558013) has the molecular formula C17H17ClN4O3 and a molecular weight of 360.80 g/mol. Its IUPAC name is 3-[4-(4-chloro-3,5-dimethylpyrazol-1-yl)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-[4-(4-chloro-3,5-dimethylpyrazol-1-yl)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168558013 |
| Molecular Formula | C17H17ClN4O3 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 3-[4-(4-chloro-3,5-dimethylpyrazol-1-yl)anilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | Cc1nn(-c2ccc(NC3=CC(=O)N(CCO)C3=O)cc2)c(C)c1Cl |
| InChI | InChI=1S/C17H17ClN4O3/c1-10-16(18)11(2)22(20-10)13-5-3-12(4-6-13)19-14-9-15(24)21(7-8-23)17(14)25/h3-6,9,19,23H,7-8H2,1-2H3 |
| InChIKey | TXWTWFOVKXJOQM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|