C22H18N4O5 — CID 168557829
1-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]-5-phenylpyrazole-3-carboxylic acid (PubChem CID 168557829) has the molecular formula C22H18N4O5 and a molecular weight of 418.41 g/mol. Its IUPAC name is 1-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]-5-phenylpyrazole-3-carboxylic acid.
| Compound Name | 1-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]-5-phenylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 168557829 |
| Molecular Formula | C22H18N4O5 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 1-[4-[[1-(2-hydroxyethyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]-5-phenylpyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccccc2)n(-c2ccc(NC3=CC(=O)N(CCO)C3=O)cc2)n1 |
| InChI | InChI=1S/C22H18N4O5/c27-11-10-25-20(28)13-17(21(25)29)23-15-6-8-16(9-7-15)26-19(12-18(24-26)22(30)31)14-4-2-1-3-5-14/h1-9,12-13,23,27H,10-11H2,(H,30,31) |
| InChIKey | IENYJXPSBDBPPV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|