C20H19F3N4O3 — CID 168557619
1-(2-hydroxyethyl)-3-[4-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]anilino]pyrrole-2,5-dione (PubChem CID 168557619) has the molecular formula C20H19F3N4O3 and a molecular weight of 420.39 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[4-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]anilino]pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-[4-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168557619 |
| Molecular Formula | C20H19F3N4O3 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[4-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]anilino]pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2ccc(-n3nc(C(F)(F)F)c4c3CCCC4)cc2)C(=O)N1CCO |
| InChI | InChI=1S/C20H19F3N4O3/c21-20(22,23)18-14-3-1-2-4-16(14)27(25-18)13-7-5-12(6-8-13)24-15-11-17(29)26(9-10-28)19(15)30/h5-8,11,24,28H,1-4,9-10H2 |
| InChIKey | VRVRKANPLATJDD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|