C18H13N9S — CID 169344494
3-[4-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169344494) has the molecular formula C18H13N9S and a molecular weight of 387.43 g/mol. Its IUPAC name is 3-[4-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[4-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169344494 |
| Molecular Formula | C18H13N9S |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 3-[4-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccc(Nc2nc(-c3ccccn3)cs2)cc1)c1nn[nH]n1 |
| InChI | InChI=1S/C18H13N9S/c19-9-12(17-24-26-27-25-17)10-21-13-4-6-14(7-5-13)22-18-23-16(11-28-18)15-3-1-2-8-20-15/h1-8,10-11,21H,(H,22,23)(H,24,25,26,27) |
| InChIKey | ROQMHGIJCMMPAG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 128.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|