C18H12N8S — CID 169345812
3-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169345812) has the molecular formula C18H12N8S and a molecular weight of 372.42 g/mol. Its IUPAC name is 3-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169345812 |
| Molecular Formula | C18H12N8S |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 3-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1cccc(-c2csc(-c3cccnc3)n2)c1)c1nn[nH]n1 |
| InChI | InChI=1S/C18H12N8S/c19-8-14(17-23-25-26-24-17)10-21-15-5-1-3-12(7-15)16-11-27-18(22-16)13-4-2-6-20-9-13/h1-7,9-11,21H,(H,23,24,25,26) |
| InChIKey | HBSFUKRWQQSDIL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|