C21H17N7S — CID 169345538
3-[3-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169345538) has the molecular formula C21H17N7S and a molecular weight of 399.48 g/mol. Its IUPAC name is 3-[3-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[3-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169345538 |
| Molecular Formula | C21H17N7S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 3-[3-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | Cc1ccc(-c2csc(-c3cccc(NC=C(C#N)c4nn[nH]n4)c3)n2)c(C)c1 |
| InChI | InChI=1S/C21H17N7S/c1-13-6-7-18(14(2)8-13)19-12-29-21(24-19)15-4-3-5-17(9-15)23-11-16(10-22)20-25-27-28-26-20/h3-9,11-12,23H,1-2H3,(H,25,26,27,28) |
| InChIKey | OZCYILCMBTUVJY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|