C21H19N3S — CID 7366136
(Z)-2-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-(2-methylanilino)prop-2-enenitrile (PubChem CID 7366136) has the molecular formula C21H19N3S and a molecular weight of 345.47 g/mol. Its IUPAC name is (Z)-2-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-(2-methylanilino)prop-2-enenitrile.
| Compound Name | (Z)-2-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-(2-methylanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 7366136 |
| Molecular Formula | C21H19N3S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | (Z)-2-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-(2-methylanilino)prop-2-enenitrile |
| SMILES | Cc1ccc(-c2csc(/C(C#N)=C\Nc3ccccc3C)n2)c(C)c1 |
| InChI | InChI=1S/C21H19N3S/c1-14-8-9-18(16(3)10-14)20-13-25-21(24-20)17(11-22)12-23-19-7-5-4-6-15(19)2/h4-10,12-13,23H,1-3H3/b17-12- |
| InChIKey | BRVXFFWAUCDJJM-ATVHPVEESA-N |
| XLogP | 5.71 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|