C19H16ClN3S — CID 18558668
(E)-2-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-pyridin-3-ylprop-2-enenitrile;hydrochloride (PubChem CID 18558668) has the molecular formula C19H16ClN3S and a molecular weight of 353.88 g/mol. Its IUPAC name is (E)-2-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-pyridin-3-ylprop-2-enenitrile;hydrochloride.
| Compound Name | (E)-2-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-pyridin-3-ylprop-2-enenitrile;hydrochloride |
|---|---|
| PubChem CID | 18558668 |
| Molecular Formula | C19H16ClN3S |
| Molecular Weight | 353.88 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | (E)-2-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-pyridin-3-ylprop-2-enenitrile;hydrochloride |
| SMILES | Cc1ccc(-c2csc(/C(C#N)=C/c3cccnc3)n2)c(C)c1.Cl |
| InChI | InChI=1S/C19H15N3S.ClH/c1-13-5-6-17(14(2)8-13)18-12-23-19(22-18)16(10-20)9-15-4-3-7-21-11-15;/h3-9,11-12H,1-2H3;1H/b16-9+; |
| InChIKey | GDTQEKMSAMXEKJ-QOVZSLTQSA-N |
| XLogP | 5.31 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.88 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|