C21H16N3O4S- — CID 7157952
4-[(E)-2-cyano-2-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]ethenyl]-2-methoxy-6-nitrophenolate (PubChem CID 7157952) has the molecular formula C21H16N3O4S- and a molecular weight of 406.44 g/mol. Its IUPAC name is 4-[(E)-2-cyano-2-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]ethenyl]-2-methoxy-6-nitrophenolate.
| Compound Name | 4-[(E)-2-cyano-2-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]ethenyl]-2-methoxy-6-nitrophenolate |
|---|---|
| PubChem CID | 7157952 |
| Molecular Formula | C21H16N3O4S- |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 4-[(E)-2-cyano-2-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]ethenyl]-2-methoxy-6-nitrophenolate |
| SMILES | COc1cc(/C=C(\C#N)c2nc(-c3ccc(C)cc3C)cs2)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C21H17N3O4S/c1-12-4-5-16(13(2)6-12)17-11-29-21(23-17)15(10-22)7-14-8-18(24(26)27)20(25)19(9-14)28-3/h4-9,11,25H,1-3H3/p-1/b15-7+ |
| InChIKey | CJCHRIVQWOTBEO-VIZOYTHASA-M |
| XLogP | 4.48 |
| TPSA | 112.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|