C20H14N3O5S- — CID 7157957
4-[2-cyano-2-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]ethenyl]-2-methoxy-6-nitrophenolate (PubChem CID 7157957) has the molecular formula C20H14N3O5S- and a molecular weight of 408.42 g/mol. Its IUPAC name is 4-[2-cyano-2-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]ethenyl]-2-methoxy-6-nitrophenolate.
| Compound Name | 4-[2-cyano-2-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]ethenyl]-2-methoxy-6-nitrophenolate |
|---|---|
| PubChem CID | 7157957 |
| Molecular Formula | C20H14N3O5S- |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 4-[2-cyano-2-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]ethenyl]-2-methoxy-6-nitrophenolate |
| SMILES | COc1cccc(-c2csc(C(C#N)=Cc3cc(OC)c([O-])c([N+](=O)[O-])c3)n2)c1 |
| InChI | InChI=1S/C20H15N3O5S/c1-27-15-5-3-4-13(9-15)16-11-29-20(22-16)14(10-21)6-12-7-17(23(25)26)19(24)18(8-12)28-2/h3-9,11,24H,1-2H3/p-1 |
| InChIKey | KHWFGGNORPUQMU-UHFFFAOYSA-M |
| XLogP | 3.87 |
| TPSA | 121.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|