C20H16BrN3S — CID 3800284
2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-(2,4-dimethylanilino)prop-2-enenitrile (PubChem CID 3800284) has the molecular formula C20H16BrN3S and a molecular weight of 410.34 g/mol. Its IUPAC name is 2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-(2,4-dimethylanilino)prop-2-enenitrile.
| Compound Name | 2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-(2,4-dimethylanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 3800284 |
| Molecular Formula | C20H16BrN3S |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | 2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-(2,4-dimethylanilino)prop-2-enenitrile |
| SMILES | Cc1ccc(NC=C(C#N)c2nc(-c3cccc(Br)c3)cs2)c(C)c1 |
| InChI | InChI=1S/C20H16BrN3S/c1-13-6-7-18(14(2)8-13)23-11-16(10-22)20-24-19(12-25-20)15-4-3-5-17(21)9-15/h3-9,11-12,23H,1-2H3 |
| InChIKey | LKLSOPOZCUQHTE-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|