C20H16BrN3OS — CID 1415172
(E)-3-(2-bromo-4-methylanilino)-2-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 1415172) has the molecular formula C20H16BrN3OS and a molecular weight of 426.34 g/mol. Its IUPAC name is (E)-3-(2-bromo-4-methylanilino)-2-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | (E)-3-(2-bromo-4-methylanilino)-2-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 1415172 |
| Molecular Formula | C20H16BrN3OS |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | (E)-3-(2-bromo-4-methylanilino)-2-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | COc1cccc(-c2csc(/C(C#N)=C/Nc3ccc(C)cc3Br)n2)c1 |
| InChI | InChI=1S/C20H16BrN3OS/c1-13-6-7-18(17(21)8-13)23-11-15(10-22)20-24-19(12-26-20)14-4-3-5-16(9-14)25-2/h3-9,11-12,23H,1-2H3/b15-11+ |
| InChIKey | WTCDJLYELVTDNG-RVDMUPIBSA-N |
| XLogP | 5.87 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|