C18H11BrN4O2S — CID 2856378
(E)-3-(2-bromo-4-nitroanilino)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 2856378) has the molecular formula C18H11BrN4O2S and a molecular weight of 427.28 g/mol. Its IUPAC name is (E)-3-(2-bromo-4-nitroanilino)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(2-bromo-4-nitroanilino)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2856378 |
| Molecular Formula | C18H11BrN4O2S |
| Molecular Weight | 427.28 g/mol |
| Exact Mass | 425.98 |
| IUPAC Name | (E)-3-(2-bromo-4-nitroanilino)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\Nc1ccc([N+](=O)[O-])cc1Br)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H11BrN4O2S/c19-15-8-14(23(24)25)6-7-16(15)21-10-13(9-20)18-22-17(11-26-18)12-4-2-1-3-5-12/h1-8,10-11,21H/b13-10+ |
| InChIKey | FBXVTUZTLWPEGM-JLHYYAGUSA-N |
| XLogP | 5.46 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.28 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|