C19H13N5O3S — CID 3606787
2-[[2-cyano-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]ethenyl]amino]benzamide (PubChem CID 3606787) has the molecular formula C19H13N5O3S and a molecular weight of 391.41 g/mol. Its IUPAC name is 2-[[2-cyano-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]ethenyl]amino]benzamide.
| Compound Name | 2-[[2-cyano-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]ethenyl]amino]benzamide |
|---|---|
| PubChem CID | 3606787 |
| Molecular Formula | C19H13N5O3S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 2-[[2-cyano-2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]ethenyl]amino]benzamide |
| SMILES | N#CC(=CNc1ccccc1C(N)=O)c1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C19H13N5O3S/c20-9-13(10-22-16-7-2-1-6-15(16)18(21)25)19-23-17(11-28-19)12-4-3-5-14(8-12)24(26)27/h1-8,10-11,22H,(H2,21,25) |
| InChIKey | GMXBBFOHPNXXIV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|