C21H18N4OS — CID 4257389
2-[[2-cyano-2-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]ethenyl]amino]benzamide (PubChem CID 4257389) has the molecular formula C21H18N4OS and a molecular weight of 374.47 g/mol. Its IUPAC name is 2-[[2-cyano-2-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]ethenyl]amino]benzamide.
| Compound Name | 2-[[2-cyano-2-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]ethenyl]amino]benzamide |
|---|---|
| PubChem CID | 4257389 |
| Molecular Formula | C21H18N4OS |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 2-[[2-cyano-2-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]ethenyl]amino]benzamide |
| SMILES | CCc1ccc(-c2csc(C(C#N)=CNc3ccccc3C(N)=O)n2)cc1 |
| InChI | InChI=1S/C21H18N4OS/c1-2-14-7-9-15(10-8-14)19-13-27-21(25-19)16(11-22)12-24-18-6-4-3-5-17(18)20(23)26/h3-10,12-13,24H,2H2,1H3,(H2,23,26) |
| InChIKey | BHHDOQQYPODTHO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|