C20H17N3S — CID 3823570
3-(2-ethylanilino)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 3823570) has the molecular formula C20H17N3S and a molecular weight of 331.44 g/mol. Its IUPAC name is 3-(2-ethylanilino)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | 3-(2-ethylanilino)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3823570 |
| Molecular Formula | C20H17N3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 3-(2-ethylanilino)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | CCc1ccccc1NC=C(C#N)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C20H17N3S/c1-2-15-8-6-7-11-18(15)22-13-17(12-21)20-23-19(14-24-20)16-9-4-3-5-10-16/h3-11,13-14,22H,2H2,1H3 |
| InChIKey | HNZIBDQPXKNZAS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|