C26H21N3S — CID 3849433
3-(4-ethylanilino)-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 3849433) has the molecular formula C26H21N3S and a molecular weight of 407.54 g/mol. Its IUPAC name is 3-(4-ethylanilino)-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-(4-ethylanilino)-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3849433 |
| Molecular Formula | C26H21N3S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 3-(4-ethylanilino)-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | CCc1ccc(NC=C(C#N)c2nc(-c3ccc(-c4ccccc4)cc3)cs2)cc1 |
| InChI | InChI=1S/C26H21N3S/c1-2-19-8-14-24(15-9-19)28-17-23(16-27)26-29-25(18-30-26)22-12-10-21(11-13-22)20-6-4-3-5-7-20/h3-15,17-18,28H,2H2,1H3 |
| InChIKey | WHGVWFVYHVTBRT-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|