C23H16N4O3S — CID 6272402
(E)-3-(4-methoxy-2-nitroanilino)-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 6272402) has the molecular formula C23H16N4O3S and a molecular weight of 428.47 g/mol. Its IUPAC name is (E)-3-(4-methoxy-2-nitroanilino)-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(4-methoxy-2-nitroanilino)-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6272402 |
| Molecular Formula | C23H16N4O3S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | (E)-3-(4-methoxy-2-nitroanilino)-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | COc1ccc(N/C=C(\C#N)c2nc(-c3ccc4ccccc4c3)cs2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H16N4O3S/c1-30-19-8-9-20(22(11-19)27(28)29)25-13-18(12-24)23-26-21(14-31-23)17-7-6-15-4-2-3-5-16(15)10-17/h2-11,13-14,25H,1H3/b18-13+ |
| InChIKey | SWQQUTUVQVGUDT-QGOAFFKASA-N |
| XLogP | 5.86 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|