C22H13F2N3S — CID 3802055
3-(2,4-difluoroanilino)-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 3802055) has the molecular formula C22H13F2N3S and a molecular weight of 389.43 g/mol. Its IUPAC name is 3-(2,4-difluoroanilino)-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | 3-(2,4-difluoroanilino)-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3802055 |
| Molecular Formula | C22H13F2N3S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 3-(2,4-difluoroanilino)-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccc(F)cc1F)c1nc(-c2ccc3ccccc3c2)cs1 |
| InChI | InChI=1S/C22H13F2N3S/c23-18-7-8-20(19(24)10-18)26-12-17(11-25)22-27-21(13-28-22)16-6-5-14-3-1-2-4-15(14)9-16/h1-10,12-13,26H |
| InChIKey | UEHGRACTEUFTHD-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|