C18H13BrN4S — CID 3769740
2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-[(4-methyl-2-pyridinyl)amino]prop-2-enenitrile (PubChem CID 3769740) has the molecular formula C18H13BrN4S and a molecular weight of 397.30 g/mol. Its IUPAC name is 2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-[(4-methyl-2-pyridinyl)amino]prop-2-enenitrile.
| Compound Name | 2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-[(4-methyl-2-pyridinyl)amino]prop-2-enenitrile |
|---|---|
| PubChem CID | 3769740 |
| Molecular Formula | C18H13BrN4S |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 396.00 |
| IUPAC Name | 2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-[(4-methyl-2-pyridinyl)amino]prop-2-enenitrile |
| SMILES | Cc1ccnc(NC=C(C#N)c2nc(-c3cccc(Br)c3)cs2)c1 |
| InChI | InChI=1S/C18H13BrN4S/c1-12-5-6-21-17(7-12)22-10-14(9-20)18-23-16(11-24-18)13-3-2-4-15(19)8-13/h2-8,10-11H,1H3,(H,21,22) |
| InChIKey | UZNDPMAQPRLWSG-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|