C22H16BrN3O4S — CID 1393138
dimethyl 2-[[(E)-2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2-cyanoethenyl]amino]benzene-1,4-dicarboxylate (PubChem CID 1393138) has the molecular formula C22H16BrN3O4S and a molecular weight of 498.36 g/mol. Its IUPAC name is dimethyl 2-[[(E)-2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2-cyanoethenyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[(E)-2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2-cyanoethenyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 1393138 |
| Molecular Formula | C22H16BrN3O4S |
| Molecular Weight | 498.36 g/mol |
| Exact Mass | 497.00 |
| IUPAC Name | dimethyl 2-[[(E)-2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2-cyanoethenyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(N/C=C(\C#N)c2nc(-c3cccc(Br)c3)cs2)c1 |
| InChI | InChI=1S/C22H16BrN3O4S/c1-29-21(27)14-6-7-17(22(28)30-2)18(9-14)25-11-15(10-24)20-26-19(12-31-20)13-4-3-5-16(23)8-13/h3-9,11-12,25H,1-2H3/b15-11+ |
| InChIKey | UUESWGUPQBGEHC-RVDMUPIBSA-N |
| XLogP | 5.12 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.36 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|