C26H25N3O4S — CID 1416018
dimethyl 2-[[2-cyano-2-[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]ethenyl]amino]benzene-1,4-dicarboxylate (PubChem CID 1416018) has the molecular formula C26H25N3O4S and a molecular weight of 475.57 g/mol. Its IUPAC name is dimethyl 2-[[2-cyano-2-[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]ethenyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[2-cyano-2-[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]ethenyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 1416018 |
| Molecular Formula | C26H25N3O4S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | dimethyl 2-[[2-cyano-2-[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]ethenyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC=C(C#N)c2nc(-c3ccc(CC(C)C)cc3)cs2)c1 |
| InChI | InChI=1S/C26H25N3O4S/c1-16(2)11-17-5-7-18(8-6-17)23-15-34-24(29-23)20(13-27)14-28-22-12-19(25(30)32-3)9-10-21(22)26(31)33-4/h5-10,12,14-16,28H,11H2,1-4H3 |
| InChIKey | GILGUWBBLQEFKY-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|