C23H19ClF3N3S — CID 5116336
3-[4-chloro-2-(trifluoromethyl)anilino]-2-[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 5116336) has the molecular formula C23H19ClF3N3S and a molecular weight of 461.94 g/mol. Its IUPAC name is 3-[4-chloro-2-(trifluoromethyl)anilino]-2-[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-[4-chloro-2-(trifluoromethyl)anilino]-2-[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 5116336 |
| Molecular Formula | C23H19ClF3N3S |
| Molecular Weight | 461.94 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 3-[4-chloro-2-(trifluoromethyl)anilino]-2-[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | CC(C)Cc1ccc(-c2csc(C(C#N)=CNc3ccc(Cl)cc3C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C23H19ClF3N3S/c1-14(2)9-15-3-5-16(6-4-15)21-13-31-22(30-21)17(11-28)12-29-20-8-7-18(24)10-19(20)23(25,26)27/h3-8,10,12-14,29H,9H2,1-2H3 |
| InChIKey | OZLJMXXPNAYOHW-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.94 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|