C23H13ClF3N3S — CID 3816367
3-[4-chloro-2-(trifluoromethyl)anilino]-2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 3816367) has the molecular formula C23H13ClF3N3S and a molecular weight of 455.89 g/mol. Its IUPAC name is 3-[4-chloro-2-(trifluoromethyl)anilino]-2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | 3-[4-chloro-2-(trifluoromethyl)anilino]-2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3816367 |
| Molecular Formula | C23H13ClF3N3S |
| Molecular Weight | 455.89 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | 3-[4-chloro-2-(trifluoromethyl)anilino]-2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccc(Cl)cc1C(F)(F)F)c1nc(-c2cccc3ccccc23)cs1 |
| InChI | InChI=1S/C23H13ClF3N3S/c24-16-8-9-20(19(10-16)23(25,26)27)29-12-15(11-28)22-30-21(13-31-22)18-7-3-5-14-4-1-2-6-17(14)18/h1-10,12-13,29H |
| InChIKey | BOADOTCRFNGKCY-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.89 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|