C23H22FN3S — CID 6000417
(E)-3-(5-fluoro-2-methylanilino)-2-[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 6000417) has the molecular formula C23H22FN3S and a molecular weight of 391.52 g/mol. Its IUPAC name is (E)-3-(5-fluoro-2-methylanilino)-2-[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | (E)-3-(5-fluoro-2-methylanilino)-2-[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 6000417 |
| Molecular Formula | C23H22FN3S |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (E)-3-(5-fluoro-2-methylanilino)-2-[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | Cc1ccc(F)cc1N/C=C(\C#N)c1nc(-c2ccc(CC(C)C)cc2)cs1 |
| InChI | InChI=1S/C23H22FN3S/c1-15(2)10-17-5-7-18(8-6-17)22-14-28-23(27-22)19(12-25)13-26-21-11-20(24)9-4-16(21)3/h4-9,11,13-15,26H,10H2,1-3H3/b19-13+ |
| InChIKey | BCYOOVLIXGLLEI-CPNJWEJPSA-N |
| XLogP | 6.43 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|