C26H27N3O2S — CID 45029925
propyl 4-[[(E)-2-cyano-2-[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]ethenyl]amino]benzoate (PubChem CID 45029925) has the molecular formula C26H27N3O2S and a molecular weight of 445.59 g/mol. Its IUPAC name is propyl 4-[[(E)-2-cyano-2-[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]ethenyl]amino]benzoate.
| Compound Name | propyl 4-[[(E)-2-cyano-2-[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]ethenyl]amino]benzoate |
|---|---|
| PubChem CID | 45029925 |
| Molecular Formula | C26H27N3O2S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | propyl 4-[[(E)-2-cyano-2-[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]ethenyl]amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(N/C=C(\C#N)c2nc(-c3ccc(CC(C)C)cc3)cs2)cc1 |
| InChI | InChI=1S/C26H27N3O2S/c1-4-13-31-26(30)21-9-11-23(12-10-21)28-16-22(15-27)25-29-24(17-32-25)20-7-5-19(6-8-20)14-18(2)3/h5-12,16-18,28H,4,13-14H2,1-3H3/b22-16+ |
| InChIKey | FYVMFGPLONWONQ-CJLVFECKSA-N |
| XLogP | 6.55 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|