C23H21N3O2S — CID 27636628
propyl 4-[[(E)-2-cyano-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]ethenyl]amino]benzoate (PubChem CID 27636628) has the molecular formula C23H21N3O2S and a molecular weight of 403.51 g/mol. Its IUPAC name is propyl 4-[[(E)-2-cyano-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]ethenyl]amino]benzoate.
| Compound Name | propyl 4-[[(E)-2-cyano-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]ethenyl]amino]benzoate |
|---|---|
| PubChem CID | 27636628 |
| Molecular Formula | C23H21N3O2S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | propyl 4-[[(E)-2-cyano-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]ethenyl]amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(N/C=C(\C#N)c2nc(-c3ccc(C)cc3)cs2)cc1 |
| InChI | InChI=1S/C23H21N3O2S/c1-3-12-28-23(27)18-8-10-20(11-9-18)25-14-19(13-24)22-26-21(15-29-22)17-6-4-16(2)5-7-17/h4-11,14-15,25H,3,12H2,1-2H3/b19-14+ |
| InChIKey | RFULJVVDDYIPQW-XMHGGMMESA-N |
| XLogP | 5.66 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|